Students and Teachers Forum
We have given, A + B + C = π/2 or, A + B = π/2 - C Operating both sides by cos, w eget .....
Here, Tan2A - TanA = 0 or, Tan2A - TanA = 0 or, 2TanA/(1 - Tan2A) - Tan A = 0 or, TanA {(2 / (1 - Tan2A) - 1} = 0 or, Either, TanA = 0 ⟹ TanA = Tan0o, Tan180o ⟹ A = 0o, 180o. Or, 2 / (1 - .....
LHS = cos(π/15) cos(2π/15) cos(4π/15) cos(8π/15) = cos(π/15) cos(2π/15) cos(4π/15) cos(8π/15) = 16sin(π/15) cos(π/15) cos(2π/15) cos(4π/15) .....
History of Nepal portrays Ranas rule as tyrannical one that centarlised all the authority and power within the Rana clan only depriving ordinary citizens of their fundamental rights. It is often regarded as the rule by people not by law. It was .....
मिलाएर उत्तर लेख्नुहोस् है त .....
Here, Volume of wall (V) = L ⨯ B ⨯ H = 150m ⨯ .....
School is the place where we learn to read and write. We need to take care of our school belongings. Some of the ways we can take care of our school belongings are: place our school things at right place properly take care of the school bench .....
Calling time of Radha to Krishana is not clear. Please use AM or PM and post .....
Friction is the main factor which reduces the efficiency of a simple machine. Efficiency of a simple machine can be increased by reducing the friction. So, oiling and greasing the machine is a useful way to increase the efficiency of a .....
As we know, VR of pully is equal to the number of pully used. So, If no.of pully increased, VR also increased. Again, Efficiency = MA/VR or, MA = Efficiency ⨯ .....
Please post complete .....
Here, LHS = sin 10° cos20° sin 30° cos40°
= ½ sin 10° cos20° cos40° .....
Here, LHS = Cos80°cos160°cos320° = Cos80°cos(180 - 20)°cos(360 - 40)° = Cos80°{-cos20°}{cos40°} = .....
The difference between internal and international migration is shown in the table .....
Rights especially addressing the proper care and the development of children may be termed as child rights. Children need special protection because they are among the most vulnerable members of society. They are dependent on others - their .....
Family is one most fundamental unit that is responsible for addressing child rights. Family can ensure child right in the following ways: by providing them the necessary care and protection by providing them the right environment for the proper .....
Children’s rights were recognised after the 1st World war, with the adoption of the Declaration of Geneva, in 1924. The process of recognition of children’s rights continued with the adoption of the Declaration of children’s .....
We use step-down transfer to play a radio with 12 volts in the electric line of 24 .....
Here, Given: AD is median. To prove: Area of ∆ABP = Area of ∆APC. Proof: Statements .....
Here, x(y2 + 1) + y(x2 + 1) = xy2 + x + yx2 + y = x2y + xy2 + x + y = xy(x + y) + 1(x + y) = (x + y)(xy + 1) is the required .....
Let te common ratio be x, then l = 3x , b = 2x & h = x Now, Volume = l × b × h or, 48cm3 = 3x × 2x × 1x or, 48cm3 = 6x³ or, 48/6 = x³ or, 8cm3 = .....
Here, Diagonal of square (d) = 4√2cm. Area = ? We know, Area of square = 1/2 × d2 .....
सङ्क्षिप्त वा छोटो उत्तरलेखन
Here, Let x-intercept be A and y-intercept be B. Then, Area of triangle = 1/2 ⨯ A ⨯ B or, 4 = 1/2 ⨯ A ⨯ 6 or, A = 8/6 = 4/3. Finally, Equation of st.line is .....
Here, Surface area of a cuboid = 1070cm2. Or, 6a2 = 1070cm2 or, a2 = 1070/6 = 535/3 cm2. Now, Surface area of solid = 2 ⨯ 1070 - 2a .....
Here, LHS = (sinA + secA)2 +( cosA + CosecA)2
Breaking whole equare, we get = sin2A +sec2A +2sinAsecA +cos2A +cosec2A +2cosAcosecA
= (sin2A + cos2A) + (sec2A +cosec2A) +( 2sinA/cosA + .....
Here, LHS = sin(s-a)+sin(s-b)+sin(s-c)-sins Now, Using the formula of sinC + sinD and sinC – sin D we get = 2Sin(2s-(A+B))/2 × Cos-(A-B)/2 + 2Cos(2s-c)/2 × Sin-c/2 = 2Sinc/2 [cos(A-B)/2 - cos(A+B)/2] = 2Sinc/2 .....
Let f = father's age Let s = son's age Write an equation for each statement. "The sum of the ages of a father and his son is 40 years.' f + s = 40 or, s = (40-f)........................i) If they both live until the son becomes .....
89% in to fraction: Do convert % into fraction, we divide it by 100. So, 89% = 89/100. In decimal, 89% = 89/100 = .....
Water is made up of two elements, hydrogen, and oxygen. It is comprised of two molecules of hydrogen and one oxygen molecule. Its chemical formula .....
क्रियाको सुरुमा, बीचमा र अन्त्यमा न थपेर अकरण बनाइन्छ । जस्तैः जालाः नजाला गएछः .....
In other words, human rights are rights inherent to all human beings. These rights are inherent regardless of race, sex, nationality, ethnicity, language, religion, or any other status. Human rights include; - the right to life and liberty, - .....
Globalization is the process in which people, ideas and goods spread throughout the world. Interaction and integration among the people, companies, and governments of different nations is given due emphasis in globalization. There are several .....
Sponges are members of the Phylum Porifera, which contains the simplest invertebrates. A sponge, being a filter-feeding animal, has thousands of little pores and canals running through its body. Water is drawn in and shunted throughout its tissue .....
We know that, The hour hand completes one complete rotation in 12 hours. So,12 hours = 360o Now, When it is 3:00, the hour hand moves, = 3 hours Now, 3 hours = 360/12 ⨯ 3 = 90o Now, you may also know that, For minute hand, 60 minutes = .....
Here, a2x2 - a(b + c)x + bc = 0 or, a2x2 - abx - acx + bc = 0 or, ax(ax - b) - c(ax - b) = 0 or, (ax - b)(ax - c) = 0 Either, ax - b = 0 ⟹ ax = .....
Global warming is a phenomenon of climate change characterized by a general increase in average temperatures of the Earth, which modifies the weather balances and ecosystems for a long time. It is directly linked to the increase of greenhouse gases .....
It converts mechanical energy to electrical .....
Step down transformer: If (Ns greater than NP) and (Vs is greater Vp) such a transformer in which .....
Here, LHS = cosA sinB sinC + sinA sinB cosC - cosA cosB cosC = cosA sinB sinC + cosC(sinA sinB - cosA cosB) = cosA sinB sinC - cosC (cosA cosB - sinA sinB) = cosA sinB sinC - cosC cos(A + B) .....
Nepal has chosen federal system of government. The country is run and governed by the representatives of the people. Five year of stable government has formed and country has reformed into federal structure. The major political events that .....
United Nations Organization is an intergovernmental organization established to maintain peace in the world. The United Nations officially came into existence on 24 October .....
Here, Let loss be x. So, from the 1st case, Loss = CP - SP or, x = CP - 384. or, CP = x + 384..............(i) .....
Let the two numbers be x & y. From the first condition, x + y = 300...........(i) From the second condition, x - y = .....
Here, SP with VAT = SP + VAT % of SP or, 99000 = SP + 10/100 x SP or, 99000 = 11SP/10 or, SP = 90000. Again, SP = MP .....